C12H23NO — CID 89190333
(E,3S,4R,5R)-4,5-dimethyl-3-(methylamino)non-7-en-2-one (PubChem CID 89190333) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is (E,3S,4R,5R)-4,5-dimethyl-3-(methylamino)non-7-en-2-one.
| Compound Name | (E,3S,4R,5R)-4,5-dimethyl-3-(methylamino)non-7-en-2-one |
|---|---|
| PubChem CID | 89190333 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | (E,3S,4R,5R)-4,5-dimethyl-3-(methylamino)non-7-en-2-one |
| SMILES | C/C=C/C[C@@H](C)[C@@H](C)[C@H](NC)C(C)=O |
| InChI | InChI=1S/C12H23NO/c1-6-7-8-9(2)10(3)12(13-5)11(4)14/h6-7,9-10,12-13H,8H2,1-5H3/b7-6+/t9-,10-,12+/m1/s1 |
| InChIKey | LNVUXZIGEBZZIO-GGIHWPAGSA-N |
| XLogP | 2.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|