C11H24N2 — CID 89190555
(Z)-N,N,N'-trimethyl-N'-propan-2-ylpent-2-ene-1,5-diamine (PubChem CID 89190555) has the molecular formula C11H24N2 and a molecular weight of 184.33 g/mol. Its IUPAC name is (Z)-N,N,N'-trimethyl-N'-propan-2-ylpent-2-ene-1,5-diamine.
| Compound Name | (Z)-N,N,N'-trimethyl-N'-propan-2-ylpent-2-ene-1,5-diamine |
|---|---|
| PubChem CID | 89190555 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | (Z)-N,N,N'-trimethyl-N'-propan-2-ylpent-2-ene-1,5-diamine |
| SMILES | CC(C)N(C)CC/C=C\CN(C)C |
| InChI | InChI=1S/C11H24N2/c1-11(2)13(5)10-8-6-7-9-12(3)4/h6-7,11H,8-10H2,1-5H3/b7-6- |
| InChIKey | WLXSWZTZIUQFFH-SREVYHEPSA-N |
| XLogP | 1.83 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|