C29H58O6Si2 — CID 89190696
[(2S)-2-[(2R)-3-[(2S,3S,4R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyhept-6-en-2-yl]-3-methyloxiran-2-yl]propyl] acetate (PubChem CID 89190696) has the molecular formula C29H58O6Si2 and a molecular weight of 558.95 g/mol. Its IUPAC name is [(2S)-2-[(2R)-3-[(2S,3S,4R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyhept-6-en-2-yl]-3-methyloxiran-2-yl]propyl] acetate.
| Compound Name | [(2S)-2-[(2R)-3-[(2S,3S,4R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyhept-6-en-2-yl]-3-methyloxiran-2-yl]propyl] acetate |
|---|---|
| PubChem CID | 89190696 |
| Molecular Formula | C29H58O6Si2 |
| Molecular Weight | 558.95 g/mol |
| Exact Mass | 558.38 |
| IUPAC Name | [(2S)-2-[(2R)-3-[(2S,3S,4R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyhept-6-en-2-yl]-3-methyloxiran-2-yl]propyl] acetate |
| SMILES | C=C[C@@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](CO[Si](C)(C)C(C)(C)C)[C@H](C)C1(C)O[C@@H]1[C@@H](C)COC(C)=O |
| InChI | InChI=1S/C29H58O6Si2/c1-16-23(18-33-36(12,13)27(5,6)7)25(31)24(19-34-37(14,15)28(8,9)10)21(3)29(11)26(35-29)20(2)17-32-22(4)30/h16,20-21,23-26,31H,1,17-19H2,2-15H3/t20-,21-,23-,24+,25+,26+,29?/m0/s1 |
| InChIKey | FKCXKTWKANBVDY-FNLBGGBHSA-N |
| XLogP | 6.80 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.95 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|