C28H56O7Si2 — CID 89190709
[(2S)-2-[(2R)-3-[(2S,3S,4S,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxy-6-oxohexan-2-yl]-3-methyloxiran-2-yl]propyl] acetate (PubChem CID 89190709) has the molecular formula C28H56O7Si2 and a molecular weight of 560.92 g/mol. Its IUPAC name is [(2S)-2-[(2R)-3-[(2S,3S,4S,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxy-6-oxohexan-2-yl]-3-methyloxiran-2-yl]propyl] acetate.
| Compound Name | [(2S)-2-[(2R)-3-[(2S,3S,4S,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxy-6-oxohexan-2-yl]-3-methyloxiran-2-yl]propyl] acetate |
|---|---|
| PubChem CID | 89190709 |
| Molecular Formula | C28H56O7Si2 |
| Molecular Weight | 560.92 g/mol |
| Exact Mass | 560.36 |
| IUPAC Name | [(2S)-2-[(2R)-3-[(2S,3S,4S,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxy-6-oxohexan-2-yl]-3-methyloxiran-2-yl]propyl] acetate |
| SMILES | CC(=O)OC[C@H](C)[C@H]1OC1(C)[C@@H](C)[C@@H](CO[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](C=O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H56O7Si2/c1-19(16-32-21(3)30)25-28(10,35-25)20(2)23(18-34-37(13,14)27(7,8)9)24(31)22(15-29)17-33-36(11,12)26(4,5)6/h15,19-20,22-25,31H,16-18H2,1-14H3/t19-,20-,22-,23+,24+,25+,28?/m0/s1 |
| InChIKey | UFBAMIZXELCBNO-PDSDASBDSA-N |
| XLogP | 5.82 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.92 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|