C27H48O8Si — CID 89190766
[(2R)-2-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(3R)-2-methyl-3-[(Z,2S)-pent-3-en-2-yl]oxiran-2-yl]methyl]-3-[(3R,4S)-6-ethyl-4,6-dihydroxyoxan-3-yl]-3-oxopropyl] acetate (PubChem CID 89190766) has the molecular formula C27H48O8Si and a molecular weight of 528.76 g/mol. Its IUPAC name is [(2R)-2-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(3R)-2-methyl-3-[(Z,2S)-pent-3-en-2-yl]oxiran-2-yl]methyl]-3-[(3R,4S)-6-ethyl-4,6-dihydroxyoxan-3-yl]-3-oxopropyl] acetate.
| Compound Name | [(2R)-2-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(3R)-2-methyl-3-[(Z,2S)-pent-3-en-2-yl]oxiran-2-yl]methyl]-3-[(3R,4S)-6-ethyl-4,6-dihydroxyoxan-3-yl]-3-oxopropyl] acetate |
|---|---|
| PubChem CID | 89190766 |
| Molecular Formula | C27H48O8Si |
| Molecular Weight | 528.76 g/mol |
| Exact Mass | 528.31 |
| IUPAC Name | [(2R)-2-[(S)-[tert-butyl(dimethyl)silyl]oxy-[(3R)-2-methyl-3-[(Z,2S)-pent-3-en-2-yl]oxiran-2-yl]methyl]-3-[(3R,4S)-6-ethyl-4,6-dihydroxyoxan-3-yl]-3-oxopropyl] acetate |
| SMILES | C/C=C\[C@H](C)[C@H]1OC1(C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](COC(C)=O)C(=O)[C@@H]1COC(O)(CC)C[C@@H]1O |
| InChI | InChI=1S/C27H48O8Si/c1-11-13-17(3)23-26(8,34-23)24(35-36(9,10)25(5,6)7)20(15-32-18(4)28)22(30)19-16-33-27(31,12-2)14-21(19)29/h11,13,17,19-21,23-24,29,31H,12,14-16H2,1-10H3/b13-11-/t17-,19+,20-,21-,23+,24-,26?,27?/m0/s1 |
| InChIKey | JNWMZZTXCUWILL-DVDUMVRKSA-N |
| XLogP | 3.99 |
| TPSA | 114.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.76 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|