C12H18O — CID 89190772
(5R)-6-ethyl-5-methyl-3,4,5,6-tetrahydro-2H-chromene (PubChem CID 89190772) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is (5R)-6-ethyl-5-methyl-3,4,5,6-tetrahydro-2H-chromene.
| Compound Name | (5R)-6-ethyl-5-methyl-3,4,5,6-tetrahydro-2H-chromene |
|---|---|
| PubChem CID | 89190772 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | (5R)-6-ethyl-5-methyl-3,4,5,6-tetrahydro-2H-chromene |
| SMILES | CCC1C=CC2=C(CCCO2)[C@@H]1C |
| InChI | InChI=1S/C12H18O/c1-3-10-6-7-12-11(9(10)2)5-4-8-13-12/h6-7,9-10H,3-5,8H2,1-2H3/t9-,10?/m1/s1 |
| InChIKey | NEYUNCOFLNURHD-YHMJZVADSA-N |
| XLogP | 3.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |