About 3-prop-1-en-2-yloxy-2,3-dihydrothiochromen-4-one
3-prop-1-en-2-yloxy-2,3-dihydrothiochromen-4-one (PubChem CID 89190939) has the molecular formula C12H12O2S
and a molecular weight of 220.29 g/mol. Its IUPAC name is 3-prop-1-en-2-yloxy-2,3-dihydrothiochromen-4-one.
Molecular Properties
| Compound Name | 3-prop-1-en-2-yloxy-2,3-dihydrothiochromen-4-one |
| PubChem CID | 89190939 |
| Molecular Formula | C12H12O2S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 3-prop-1-en-2-yloxy-2,3-dihydrothiochromen-4-one |
| SMILES | C=C(C)OC1CSc2ccccc2C1=O |
| InChI | InChI=1S/C12H12O2S/c1-8(2)14-10-7-15-11-6-4-3-5-9(11)12(10)13/h3-6,10H,1,7H2,2H3 |
| InChIKey | PBQKZNDOFGSGKI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 3-prop-1-en-2-yloxy-2,3-dihydrothiochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-prop-1-en-2-yloxy-2,3-dihydrothiochromen-4-one?
The IUPAC name of 3-prop-1-en-2-yloxy-2,3-dihydrothiochromen-4-one (CID 89190939) is 3-prop-1-en-2-yloxy-2,3-dihydrothiochromen-4-one.
What is the SMILES notation for 3-prop-1-en-2-yloxy-2,3-dihydrothiochromen-4-one?
The canonical SMILES for 3-prop-1-en-2-yloxy-2,3-dihydrothiochromen-4-one is C=C(C)OC1CSc2ccccc2C1=O.
What is the InChIKey of 3-prop-1-en-2-yloxy-2,3-dihydrothiochromen-4-one?
The InChIKey is PBQKZNDOFGSGKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O2S/c1-8(2)14-10-7-15-11-6-4-3-5-9(11)12(10)13/h3-6,10H,1,7H2,2H3.
What are the key properties of 3-prop-1-en-2-yloxy-2,3-dihydrothiochromen-4-one?
3-prop-1-en-2-yloxy-2,3-dihydrothiochromen-4-one has a molecular weight of 220.29 g/mol, XLogP of 2.89, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-prop-1-en-2-yloxy-2,3-dihydrothiochromen-4-one is sourced from PubChem (CID 89190939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).