About 2-methylidene-3H-benzo[g][1,3]benzothiazole
2-methylidene-3H-benzo[g][1,3]benzothiazole (PubChem CID 89191237) has the molecular formula C12H9NS
and a molecular weight of 199.28 g/mol. Its IUPAC name is 2-methylidene-3H-benzo[g][1,3]benzothiazole.
Molecular Properties
| Compound Name | 2-methylidene-3H-benzo[g][1,3]benzothiazole |
| PubChem CID | 89191237 |
| Molecular Formula | C12H9NS |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | 2-methylidene-3H-benzo[g][1,3]benzothiazole |
| SMILES | C=C1Nc2ccc3ccccc3c2S1 |
| InChI | InChI=1S/C12H9NS/c1-8-13-11-7-6-9-4-2-3-5-10(9)12(11)14-8/h2-7,13H,1H2 |
| InChIKey | KHPLZFJBKHHZJV-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylidene-3H-benzo[g][1,3]benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylidene-3H-benzo[g][1,3]benzothiazole?
The IUPAC name of 2-methylidene-3H-benzo[g][1,3]benzothiazole (CID 89191237) is 2-methylidene-3H-benzo[g][1,3]benzothiazole.
What is the SMILES notation for 2-methylidene-3H-benzo[g][1,3]benzothiazole?
The canonical SMILES for 2-methylidene-3H-benzo[g][1,3]benzothiazole is C=C1Nc2ccc3ccccc3c2S1.
What is the InChIKey of 2-methylidene-3H-benzo[g][1,3]benzothiazole?
The InChIKey is KHPLZFJBKHHZJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NS/c1-8-13-11-7-6-9-4-2-3-5-10(9)12(11)14-8/h2-7,13H,1H2.
What are the key properties of 2-methylidene-3H-benzo[g][1,3]benzothiazole?
2-methylidene-3H-benzo[g][1,3]benzothiazole has a molecular weight of 199.28 g/mol, XLogP of 3.83, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidene-3H-benzo[g][1,3]benzothiazole is sourced from PubChem (CID 89191237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).