C22H21F3N4O3 — CID 89191296
N-[2-(2-methylpiperidin-1-yl)-5-[3-[2-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]phenyl]methanimine oxide (PubChem CID 89191296) has the molecular formula C22H21F3N4O3 and a molecular weight of 446.43 g/mol. Its IUPAC name is N-[2-(2-methylpiperidin-1-yl)-5-[3-[2-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]phenyl]methanimine oxide.
| Compound Name | N-[2-(2-methylpiperidin-1-yl)-5-[3-[2-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]phenyl]methanimine oxide |
|---|---|
| PubChem CID | 89191296 |
| Molecular Formula | C22H21F3N4O3 |
| Molecular Weight | 446.43 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | N-[2-(2-methylpiperidin-1-yl)-5-[3-[2-(trifluoromethoxy)phenyl]-1,2,4-oxadiazol-5-yl]phenyl]methanimine oxide |
| SMILES | C=[N+]([O-])c1cc(-c2nc(-c3ccccc3OC(F)(F)F)no2)ccc1N1CCCCC1C |
| InChI | InChI=1S/C22H21F3N4O3/c1-14-7-5-6-12-29(14)17-11-10-15(13-18(17)28(2)30)21-26-20(27-32-21)16-8-3-4-9-19(16)31-22(23,24)25/h3-4,8-11,13-14H,2,5-7,12H2,1H3 |
| InChIKey | YCMAIHNNOWXHMK-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 77.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.43 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|