C38H18F2N4 — CID 89191341
2-[12-(dicyanomethylidene)-2,8-bis(4-fluorophenyl)-5a,10b-dihydroindeno[1,2-b]fluoren-6-ylidene]propanedinitrile (PubChem CID 89191341) has the molecular formula C38H18F2N4 and a molecular weight of 568.59 g/mol. Its IUPAC name is 2-[12-(dicyanomethylidene)-2,8-bis(4-fluorophenyl)-5a,10b-dihydroindeno[1,2-b]fluoren-6-ylidene]propanedinitrile.
| Compound Name | 2-[12-(dicyanomethylidene)-2,8-bis(4-fluorophenyl)-5a,10b-dihydroindeno[1,2-b]fluoren-6-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 89191341 |
| Molecular Formula | C38H18F2N4 |
| Molecular Weight | 568.59 g/mol |
| Exact Mass | 568.15 |
| IUPAC Name | 2-[12-(dicyanomethylidene)-2,8-bis(4-fluorophenyl)-5a,10b-dihydroindeno[1,2-b]fluoren-6-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1C2=CC3c4ccc(-c5ccc(F)cc5)cc4C(=C(C#N)C#N)C3C=C2c2ccc(-c3ccc(F)cc3)cc21 |
| InChI | InChI=1S/C38H18F2N4/c39-27-7-1-21(2-8-27)23-5-11-29-31-15-36-32(16-35(31)37(33(29)13-23)25(17-41)18-42)30-12-6-24(22-3-9-28(40)10-4-22)14-34(30)38(36)26(19-43)20-44/h1-16,31,35H |
| InChIKey | NPANKEIXAHVCMN-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.59 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|