C21H18ClF3N2O4S2 — CID 89191675
methyl (2S)-2-(chloroamino)-3-[4-[4-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl)methyl]-3-(trifluoromethyl)phenoxy]phenyl]propanoate (PubChem CID 89191675) has the molecular formula C21H18ClF3N2O4S2 and a molecular weight of 518.97 g/mol. Its IUPAC name is methyl (2S)-2-(chloroamino)-3-[4-[4-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl)methyl]-3-(trifluoromethyl)phenoxy]phenyl]propanoate.
| Compound Name | methyl (2S)-2-(chloroamino)-3-[4-[4-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl)methyl]-3-(trifluoromethyl)phenoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 89191675 |
| Molecular Formula | C21H18ClF3N2O4S2 |
| Molecular Weight | 518.97 g/mol |
| Exact Mass | 518.03 |
| IUPAC Name | methyl (2S)-2-(chloroamino)-3-[4-[4-[(4-oxo-2-sulfanylidene-1,3-thiazolidin-5-yl)methyl]-3-(trifluoromethyl)phenoxy]phenyl]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(Oc2ccc(CC3SC(=S)NC3=O)c(C(F)(F)F)c2)cc1)NCl |
| InChI | InChI=1S/C21H18ClF3N2O4S2/c1-30-19(29)16(27-22)8-11-2-5-13(6-3-11)31-14-7-4-12(15(10-14)21(23,24)25)9-17-18(28)26-20(32)33-17/h2-7,10,16-17,27H,8-9H2,1H3,(H,26,28,32)/t16-,17?/m0/s1 |
| InChIKey | UPPBHTTZBAXAFW-BHWOMJMDSA-N |
| XLogP | 4.38 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.97 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|