C19H23NO5 — CID 89192249
8-methoxy-3-nitroso-3-(2,4,5-trimethylphenyl)-1-oxaspiro[4.5]decane-2,4-dione (PubChem CID 89192249) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is 8-methoxy-3-nitroso-3-(2,4,5-trimethylphenyl)-1-oxaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-methoxy-3-nitroso-3-(2,4,5-trimethylphenyl)-1-oxaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 89192249 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 8-methoxy-3-nitroso-3-(2,4,5-trimethylphenyl)-1-oxaspiro[4.5]decane-2,4-dione |
| SMILES | COC1CCC2(CC1)OC(=O)C(N=O)(c1cc(C)c(C)cc1C)C2=O |
| InChI | InChI=1S/C19H23NO5/c1-11-9-13(3)15(10-12(11)2)19(20-23)16(21)18(25-17(19)22)7-5-14(24-4)6-8-18/h9-10,14H,5-8H2,1-4H3 |
| InChIKey | KOHUWOZDSJNLAD-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|