C9H11F3 — CID 89192254
(3Z,5E)-7,7,7-trifluoro-3,6-dimethylhepta-1,3,5-triene (PubChem CID 89192254) has the molecular formula C9H11F3 and a molecular weight of 176.18 g/mol. Its IUPAC name is (3Z,5E)-7,7,7-trifluoro-3,6-dimethylhepta-1,3,5-triene.
| Compound Name | (3Z,5E)-7,7,7-trifluoro-3,6-dimethylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 89192254 |
| Molecular Formula | C9H11F3 |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | (3Z,5E)-7,7,7-trifluoro-3,6-dimethylhepta-1,3,5-triene |
| SMILES | C=C/C(C)=C\C=C(/C)C(F)(F)F |
| InChI | InChI=1S/C9H11F3/c1-4-7(2)5-6-8(3)9(10,11)12/h4-6H,1H2,2-3H3/b7-5-,8-6+ |
| InChIKey | YXTMRFKVHKJCKR-CGXWXWIYSA-N |
| XLogP | 3.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|