About N,N,5-trimethyl-3,4-dihydropyridin-2-amine
N,N,5-trimethyl-3,4-dihydropyridin-2-amine (PubChem CID 89192259) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is N,N,5-trimethyl-3,4-dihydropyridin-2-amine.
Molecular Properties
| Compound Name | N,N,5-trimethyl-3,4-dihydropyridin-2-amine |
| PubChem CID | 89192259 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | N,N,5-trimethyl-3,4-dihydropyridin-2-amine |
| SMILES | CC1=CN=C(N(C)C)CC1 |
| InChI | InChI=1S/C8H14N2/c1-7-4-5-8(9-6-7)10(2)3/h6H,4-5H2,1-3H3 |
| InChIKey | JFGQOMGGJQRIIJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N,5-trimethyl-3,4-dihydropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N,5-trimethyl-3,4-dihydropyridin-2-amine?
The IUPAC name of N,N,5-trimethyl-3,4-dihydropyridin-2-amine (CID 89192259) is N,N,5-trimethyl-3,4-dihydropyridin-2-amine.
What is the SMILES notation for N,N,5-trimethyl-3,4-dihydropyridin-2-amine?
The canonical SMILES for N,N,5-trimethyl-3,4-dihydropyridin-2-amine is CC1=CN=C(N(C)C)CC1.
What is the InChIKey of N,N,5-trimethyl-3,4-dihydropyridin-2-amine?
The InChIKey is JFGQOMGGJQRIIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2/c1-7-4-5-8(9-6-7)10(2)3/h6H,4-5H2,1-3H3.
What are the key properties of N,N,5-trimethyl-3,4-dihydropyridin-2-amine?
N,N,5-trimethyl-3,4-dihydropyridin-2-amine has a molecular weight of 138.21 g/mol, XLogP of 1.64, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N,5-trimethyl-3,4-dihydropyridin-2-amine is sourced from PubChem (CID 89192259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).