About (8aR)-4a,8a-dihydroisoquinoline
(8aR)-4a,8a-dihydroisoquinoline (PubChem CID 89192260) has the molecular formula C9H9N
and a molecular weight of 131.18 g/mol. Its IUPAC name is (8aR)-4a,8a-dihydroisoquinoline.
Molecular Properties
| Compound Name | (8aR)-4a,8a-dihydroisoquinoline |
| PubChem CID | 89192260 |
| Molecular Formula | C9H9N |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.07 |
| IUPAC Name | (8aR)-4a,8a-dihydroisoquinoline |
| SMILES | C1=CC2C=CN=C[C@@H]2C=C1 |
| InChI | InChI=1S/C9H9N/c1-2-4-9-7-10-6-5-8(9)3-1/h1-9H/t8?,9-/m0/s1 |
| InChIKey | HYOPNGLRTNISKY-GKAPJAKFSA-N |
| XLogP | 1.94 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (8aR)-4a,8a-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8aR)-4a,8a-dihydroisoquinoline?
The IUPAC name of (8aR)-4a,8a-dihydroisoquinoline (CID 89192260) is (8aR)-4a,8a-dihydroisoquinoline.
What is the SMILES notation for (8aR)-4a,8a-dihydroisoquinoline?
The canonical SMILES for (8aR)-4a,8a-dihydroisoquinoline is C1=CC2C=CN=C[C@@H]2C=C1.
What is the InChIKey of (8aR)-4a,8a-dihydroisoquinoline?
The InChIKey is HYOPNGLRTNISKY-GKAPJAKFSA-N. The full InChI is InChI=1S/C9H9N/c1-2-4-9-7-10-6-5-8(9)3-1/h1-9H/t8?,9-/m0/s1.
What are the key properties of (8aR)-4a,8a-dihydroisoquinoline?
(8aR)-4a,8a-dihydroisoquinoline has a molecular weight of 131.18 g/mol, XLogP of 1.94, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (8aR)-4a,8a-dihydroisoquinoline is sourced from PubChem (CID 89192260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).