About 5-methyl-N,N-dipropyl-3,4-dihydropyridin-2-amine
5-methyl-N,N-dipropyl-3,4-dihydropyridin-2-amine (PubChem CID 89192335) has the molecular formula C12H22N2
and a molecular weight of 194.32 g/mol. Its IUPAC name is 5-methyl-N,N-dipropyl-3,4-dihydropyridin-2-amine.
Molecular Properties
| Compound Name | 5-methyl-N,N-dipropyl-3,4-dihydropyridin-2-amine |
| PubChem CID | 89192335 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 5-methyl-N,N-dipropyl-3,4-dihydropyridin-2-amine |
| SMILES | CCCN(CCC)C1=NC=C(C)CC1 |
| InChI | InChI=1S/C12H22N2/c1-4-8-14(9-5-2)12-7-6-11(3)10-13-12/h10H,4-9H2,1-3H3 |
| InChIKey | CVZSEHOCCCTERT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methyl-N,N-dipropyl-3,4-dihydropyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N,N-dipropyl-3,4-dihydropyridin-2-amine?
The IUPAC name of 5-methyl-N,N-dipropyl-3,4-dihydropyridin-2-amine (CID 89192335) is 5-methyl-N,N-dipropyl-3,4-dihydropyridin-2-amine.
What is the SMILES notation for 5-methyl-N,N-dipropyl-3,4-dihydropyridin-2-amine?
The canonical SMILES for 5-methyl-N,N-dipropyl-3,4-dihydropyridin-2-amine is CCCN(CCC)C1=NC=C(C)CC1.
What is the InChIKey of 5-methyl-N,N-dipropyl-3,4-dihydropyridin-2-amine?
The InChIKey is CVZSEHOCCCTERT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2/c1-4-8-14(9-5-2)12-7-6-11(3)10-13-12/h10H,4-9H2,1-3H3.
What are the key properties of 5-methyl-N,N-dipropyl-3,4-dihydropyridin-2-amine?
5-methyl-N,N-dipropyl-3,4-dihydropyridin-2-amine has a molecular weight of 194.32 g/mol, XLogP of 3.20, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N,N-dipropyl-3,4-dihydropyridin-2-amine is sourced from PubChem (CID 89192335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).