C15H22N2 — CID 89192457
(5Z)-2-(cyclohexen-1-yl)-1-methyl-9-methylidene-7,8-dihydro-4H-1,3-diazonine (PubChem CID 89192457) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is (5Z)-2-(cyclohexen-1-yl)-1-methyl-9-methylidene-7,8-dihydro-4H-1,3-diazonine.
| Compound Name | (5Z)-2-(cyclohexen-1-yl)-1-methyl-9-methylidene-7,8-dihydro-4H-1,3-diazonine |
|---|---|
| PubChem CID | 89192457 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | (5Z)-2-(cyclohexen-1-yl)-1-methyl-9-methylidene-7,8-dihydro-4H-1,3-diazonine |
| SMILES | C=C1CC/C=C\C/N=C(/C2=CCCCC2)N1C |
| InChI | InChI=1S/C15H22N2/c1-13-9-5-4-8-12-16-15(17(13)2)14-10-6-3-7-11-14/h4,8,10H,1,3,5-7,9,11-12H2,2H3/b8-4-,16-15- |
| InChIKey | QBDHVJNSQKOHKM-CETIGSGPSA-N |
| XLogP | 3.68 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|