C19H28N2 — CID 89192473
2-(cyclohexen-1-yl)-6-methyl-3-[(E)-3-methylbut-1-enyl]-3a,4,5,7a-tetrahydrobenzimidazole (PubChem CID 89192473) has the molecular formula C19H28N2 and a molecular weight of 284.45 g/mol. Its IUPAC name is 2-(cyclohexen-1-yl)-6-methyl-3-[(E)-3-methylbut-1-enyl]-3a,4,5,7a-tetrahydrobenzimidazole.
| Compound Name | 2-(cyclohexen-1-yl)-6-methyl-3-[(E)-3-methylbut-1-enyl]-3a,4,5,7a-tetrahydrobenzimidazole |
|---|---|
| PubChem CID | 89192473 |
| Molecular Formula | C19H28N2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | 2-(cyclohexen-1-yl)-6-methyl-3-[(E)-3-methylbut-1-enyl]-3a,4,5,7a-tetrahydrobenzimidazole |
| SMILES | CC1=CC2N=C(C3=CCCCC3)N(/C=C/C(C)C)C2CC1 |
| InChI | InChI=1S/C19H28N2/c1-14(2)11-12-21-18-10-9-15(3)13-17(18)20-19(21)16-7-5-4-6-8-16/h7,11-14,17-18H,4-6,8-10H2,1-3H3/b12-11+ |
| InChIKey | GEPPIPCUQVVDSI-VAWYXSNFSA-N |
| XLogP | 4.85 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|