About 5-but-3-enyl-2-(cyclohexen-1-yl)-1,4-dimethyl-4,5-dihydroimidazole
5-but-3-enyl-2-(cyclohexen-1-yl)-1,4-dimethyl-4,5-dihydroimidazole (PubChem CID 89192507) has the molecular formula C15H24N2
and a molecular weight of 232.37 g/mol. Its IUPAC name is 5-but-3-enyl-2-(cyclohexen-1-yl)-1,4-dimethyl-4,5-dihydroimidazole.
Molecular Properties
| Compound Name | 5-but-3-enyl-2-(cyclohexen-1-yl)-1,4-dimethyl-4,5-dihydroimidazole |
| PubChem CID | 89192507 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 5-but-3-enyl-2-(cyclohexen-1-yl)-1,4-dimethyl-4,5-dihydroimidazole |
| SMILES | C=CCCC1C(C)N=C(C2=CCCCC2)N1C |
| InChI | InChI=1S/C15H24N2/c1-4-5-11-14-12(2)16-15(17(14)3)13-9-7-6-8-10-13/h4,9,12,14H,1,5-8,10-11H2,2-3H3 |
| InChIKey | QMZWBMUQFZZGKE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-but-3-enyl-2-(cyclohexen-1-yl)-1,4-dimethyl-4,5-dihydroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-but-3-enyl-2-(cyclohexen-1-yl)-1,4-dimethyl-4,5-dihydroimidazole?
The IUPAC name of 5-but-3-enyl-2-(cyclohexen-1-yl)-1,4-dimethyl-4,5-dihydroimidazole (CID 89192507) is 5-but-3-enyl-2-(cyclohexen-1-yl)-1,4-dimethyl-4,5-dihydroimidazole.
What is the SMILES notation for 5-but-3-enyl-2-(cyclohexen-1-yl)-1,4-dimethyl-4,5-dihydroimidazole?
The canonical SMILES for 5-but-3-enyl-2-(cyclohexen-1-yl)-1,4-dimethyl-4,5-dihydroimidazole is C=CCCC1C(C)N=C(C2=CCCCC2)N1C.
What is the InChIKey of 5-but-3-enyl-2-(cyclohexen-1-yl)-1,4-dimethyl-4,5-dihydroimidazole?
The InChIKey is QMZWBMUQFZZGKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2/c1-4-5-11-14-12(2)16-15(17(14)3)13-9-7-6-8-10-13/h4,9,12,14H,1,5-8,10-11H2,2-3H3.
What are the key properties of 5-but-3-enyl-2-(cyclohexen-1-yl)-1,4-dimethyl-4,5-dihydroimidazole?
5-but-3-enyl-2-(cyclohexen-1-yl)-1,4-dimethyl-4,5-dihydroimidazole has a molecular weight of 232.37 g/mol, XLogP of 3.55, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-but-3-enyl-2-(cyclohexen-1-yl)-1,4-dimethyl-4,5-dihydroimidazole is sourced from PubChem (CID 89192507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).