C25H25N5O3S2 — CID 89192685
(5Z)-5-[[5-[5-methyl-2-[4-(2-pyrrolidin-1-ylethoxy)anilino]pyrimidin-4-yl]thiophen-2-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 89192685) has the molecular formula C25H25N5O3S2 and a molecular weight of 507.64 g/mol. Its IUPAC name is (5Z)-5-[[5-[5-methyl-2-[4-(2-pyrrolidin-1-ylethoxy)anilino]pyrimidin-4-yl]thiophen-2-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[5-[5-methyl-2-[4-(2-pyrrolidin-1-ylethoxy)anilino]pyrimidin-4-yl]thiophen-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 89192685 |
| Molecular Formula | C25H25N5O3S2 |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.14 |
| IUPAC Name | (5Z)-5-[[5-[5-methyl-2-[4-(2-pyrrolidin-1-ylethoxy)anilino]pyrimidin-4-yl]thiophen-2-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1cnc(Nc2ccc(OCCN3CCCC3)cc2)nc1-c1ccc(/C=C2\SC(=O)NC2=O)s1 |
| InChI | InChI=1S/C25H25N5O3S2/c1-16-15-26-24(27-17-4-6-18(7-5-17)33-13-12-30-10-2-3-11-30)28-22(16)20-9-8-19(34-20)14-21-23(31)29-25(32)35-21/h4-9,14-15H,2-3,10-13H2,1H3,(H,26,27,28)(H,29,31,32)/b21-14- |
| InChIKey | AOAZNTPROJAGGA-STZFKDTASA-N |
| XLogP | 5.06 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|