About 5-[(1Z)-buta-1,3-dienyl]-4-methyl-2,3-dihydrofuran
5-[(1Z)-buta-1,3-dienyl]-4-methyl-2,3-dihydrofuran (PubChem CID 89192695) has the molecular formula C9H12O
and a molecular weight of 136.19 g/mol. Its IUPAC name is 5-[(1Z)-buta-1,3-dienyl]-4-methyl-2,3-dihydrofuran.
Molecular Properties
| Compound Name | 5-[(1Z)-buta-1,3-dienyl]-4-methyl-2,3-dihydrofuran |
| PubChem CID | 89192695 |
| Molecular Formula | C9H12O |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.09 |
| IUPAC Name | 5-[(1Z)-buta-1,3-dienyl]-4-methyl-2,3-dihydrofuran |
| SMILES | C=C/C=C\C1=C(C)CCO1 |
| InChI | InChI=1S/C9H12O/c1-3-4-5-9-8(2)6-7-10-9/h3-5H,1,6-7H2,2H3/b5-4- |
| InChIKey | GACQPRLWDGWAIG-PLNGDYQASA-N |
| XLogP | 2.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-[(1Z)-buta-1,3-dienyl]-4-methyl-2,3-dihydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1Z)-buta-1,3-dienyl]-4-methyl-2,3-dihydrofuran?
The IUPAC name of 5-[(1Z)-buta-1,3-dienyl]-4-methyl-2,3-dihydrofuran (CID 89192695) is 5-[(1Z)-buta-1,3-dienyl]-4-methyl-2,3-dihydrofuran.
What is the SMILES notation for 5-[(1Z)-buta-1,3-dienyl]-4-methyl-2,3-dihydrofuran?
The canonical SMILES for 5-[(1Z)-buta-1,3-dienyl]-4-methyl-2,3-dihydrofuran is C=C/C=C\C1=C(C)CCO1.
What is the InChIKey of 5-[(1Z)-buta-1,3-dienyl]-4-methyl-2,3-dihydrofuran?
The InChIKey is GACQPRLWDGWAIG-PLNGDYQASA-N. The full InChI is InChI=1S/C9H12O/c1-3-4-5-9-8(2)6-7-10-9/h3-5H,1,6-7H2,2H3/b5-4-.
What are the key properties of 5-[(1Z)-buta-1,3-dienyl]-4-methyl-2,3-dihydrofuran?
5-[(1Z)-buta-1,3-dienyl]-4-methyl-2,3-dihydrofuran has a molecular weight of 136.19 g/mol, XLogP of 2.42, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1Z)-buta-1,3-dienyl]-4-methyl-2,3-dihydrofuran is sourced from PubChem (CID 89192695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).