C17H32O2 — CID 89192803
2,4-dimethylpentan-3-yl (Z)-2,7-dimethyloct-4-enoate (PubChem CID 89192803) has the molecular formula C17H32O2 and a molecular weight of 268.44 g/mol. Its IUPAC name is 2,4-dimethylpentan-3-yl (Z)-2,7-dimethyloct-4-enoate.
| Compound Name | 2,4-dimethylpentan-3-yl (Z)-2,7-dimethyloct-4-enoate |
|---|---|
| PubChem CID | 89192803 |
| Molecular Formula | C17H32O2 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.24 |
| IUPAC Name | 2,4-dimethylpentan-3-yl (Z)-2,7-dimethyloct-4-enoate |
| SMILES | CC(C)C/C=C\CC(C)C(=O)OC(C(C)C)C(C)C |
| InChI | InChI=1S/C17H32O2/c1-12(2)10-8-9-11-15(7)17(18)19-16(13(3)4)14(5)6/h8-9,12-16H,10-11H2,1-7H3/b9-8- |
| InChIKey | VJIPKKOYXLKFTF-HJWRWDBZSA-N |
| XLogP | 4.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|