C12H23NO — CID 89192989
(4Z,6Z)-3,8-dimethyl-8-(methylamino)nona-4,6-dien-1-ol (PubChem CID 89192989) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is (4Z,6Z)-3,8-dimethyl-8-(methylamino)nona-4,6-dien-1-ol.
| Compound Name | (4Z,6Z)-3,8-dimethyl-8-(methylamino)nona-4,6-dien-1-ol |
|---|---|
| PubChem CID | 89192989 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | (4Z,6Z)-3,8-dimethyl-8-(methylamino)nona-4,6-dien-1-ol |
| SMILES | CNC(C)(C)/C=C\C=C/C(C)CCO |
| InChI | InChI=1S/C12H23NO/c1-11(8-10-14)7-5-6-9-12(2,3)13-4/h5-7,9,11,13-14H,8,10H2,1-4H3/b7-5-,9-6- |
| InChIKey | JUMOXSKXDZTSLJ-BSIYMUDXSA-N |
| XLogP | 2.12 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|