C13H22ClN3O2 — CID 89193057
(9S)-3-(2-chloroethyl)-9-methyl-2-oxo-1,4,5,5a,6,7,8,9a-octahydrobenzo[d][1,3]diazepine-9-carboxamide (PubChem CID 89193057) has the molecular formula C13H22ClN3O2 and a molecular weight of 287.79 g/mol. Its IUPAC name is (9S)-3-(2-chloroethyl)-9-methyl-2-oxo-1,4,5,5a,6,7,8,9a-octahydrobenzo[d][1,3]diazepine-9-carboxamide.
| Compound Name | (9S)-3-(2-chloroethyl)-9-methyl-2-oxo-1,4,5,5a,6,7,8,9a-octahydrobenzo[d][1,3]diazepine-9-carboxamide |
|---|---|
| PubChem CID | 89193057 |
| Molecular Formula | C13H22ClN3O2 |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | (9S)-3-(2-chloroethyl)-9-methyl-2-oxo-1,4,5,5a,6,7,8,9a-octahydrobenzo[d][1,3]diazepine-9-carboxamide |
| SMILES | C[C@]1(C(N)=O)CCCC2CCN(CCCl)C(=O)NC21 |
| InChI | InChI=1S/C13H22ClN3O2/c1-13(11(15)18)5-2-3-9-4-7-17(8-6-14)12(19)16-10(9)13/h9-10H,2-8H2,1H3,(H2,15,18)(H,16,19)/t9?,10?,13-/m0/s1 |
| InChIKey | UPOBNWVRRLMGDV-ZPPKWKGLSA-N |
| XLogP | 1.30 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|