C27H32N2O3 — CID 89193067
(1S,4S,5S,16S,23R)-11-amino-4,5,24,24-tetramethyl-25,26-dioxa-7-azaheptacyclo[21.2.1.01,20.04,19.05,16.06,14.08,13]hexacosa-6(14),8(13),9,11,20-pentaen-22-one (PubChem CID 89193067) has the molecular formula C27H32N2O3 and a molecular weight of 432.56 g/mol. Its IUPAC name is (1S,4S,5S,16S,23R)-11-amino-4,5,24,24-tetramethyl-25,26-dioxa-7-azaheptacyclo[21.2.1.01,20.04,19.05,16.06,14.08,13]hexacosa-6(14),8(13),9,11,20-pentaen-22-one.
| Compound Name | (1S,4S,5S,16S,23R)-11-amino-4,5,24,24-tetramethyl-25,26-dioxa-7-azaheptacyclo[21.2.1.01,20.04,19.05,16.06,14.08,13]hexacosa-6(14),8(13),9,11,20-pentaen-22-one |
|---|---|
| PubChem CID | 89193067 |
| Molecular Formula | C27H32N2O3 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | (1S,4S,5S,16S,23R)-11-amino-4,5,24,24-tetramethyl-25,26-dioxa-7-azaheptacyclo[21.2.1.01,20.04,19.05,16.06,14.08,13]hexacosa-6(14),8(13),9,11,20-pentaen-22-one |
| SMILES | CC1(C)O[C@@]23CC[C@@]4(C)C(CC[C@H]5Cc6c([nH]c7ccc(N)cc67)[C@@]54C)C2=CC(=O)[C@@H]1O3 |
| InChI | InChI=1S/C27H32N2O3/c1-24(2)23-21(30)13-19-18-7-5-14-11-17-16-12-15(28)6-8-20(16)29-22(17)26(14,4)25(18,3)9-10-27(19,31-23)32-24/h6,8,12-14,18,23,29H,5,7,9-11,28H2,1-4H3/t14-,18?,23-,25-,26+,27-/m0/s1 |
| InChIKey | MSFXOPBKCLVSJY-SXHKRKKPSA-N |
| XLogP | 4.79 |
| TPSA | 77.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|