About 1-(2,4-dimethyl-1,3-thiazol-5-yl)-N,N-dimethylmethanamine
1-(2,4-dimethyl-1,3-thiazol-5-yl)-N,N-dimethylmethanamine (PubChem CID 89193394) has the molecular formula C8H14N2S
and a molecular weight of 170.28 g/mol. Its IUPAC name is 1-(2,4-dimethyl-1,3-thiazol-5-yl)-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-(2,4-dimethyl-1,3-thiazol-5-yl)-N,N-dimethylmethanamine |
| PubChem CID | 89193394 |
| Molecular Formula | C8H14N2S |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 1-(2,4-dimethyl-1,3-thiazol-5-yl)-N,N-dimethylmethanamine |
| SMILES | Cc1nc(C)c(CN(C)C)s1 |
| InChI | InChI=1S/C8H14N2S/c1-6-8(5-10(3)4)11-7(2)9-6/h5H2,1-4H3 |
| InChIKey | UJVYDISMDTUBFU-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2,4-dimethyl-1,3-thiazol-5-yl)-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4-dimethyl-1,3-thiazol-5-yl)-N,N-dimethylmethanamine?
The IUPAC name of 1-(2,4-dimethyl-1,3-thiazol-5-yl)-N,N-dimethylmethanamine (CID 89193394) is 1-(2,4-dimethyl-1,3-thiazol-5-yl)-N,N-dimethylmethanamine.
What is the SMILES notation for 1-(2,4-dimethyl-1,3-thiazol-5-yl)-N,N-dimethylmethanamine?
The canonical SMILES for 1-(2,4-dimethyl-1,3-thiazol-5-yl)-N,N-dimethylmethanamine is Cc1nc(C)c(CN(C)C)s1.
What is the InChIKey of 1-(2,4-dimethyl-1,3-thiazol-5-yl)-N,N-dimethylmethanamine?
The InChIKey is UJVYDISMDTUBFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2S/c1-6-8(5-10(3)4)11-7(2)9-6/h5H2,1-4H3.
What are the key properties of 1-(2,4-dimethyl-1,3-thiazol-5-yl)-N,N-dimethylmethanamine?
1-(2,4-dimethyl-1,3-thiazol-5-yl)-N,N-dimethylmethanamine has a molecular weight of 170.28 g/mol, XLogP of 1.82, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-dimethyl-1,3-thiazol-5-yl)-N,N-dimethylmethanamine is sourced from PubChem (CID 89193394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).