C10H23N3O — CID 89193516
1-methoxy-2,2,6,6-tetramethylpiperidine-4,4-diamine (PubChem CID 89193516) has the molecular formula C10H23N3O and a molecular weight of 201.31 g/mol. Its IUPAC name is 1-methoxy-2,2,6,6-tetramethylpiperidine-4,4-diamine.
| Compound Name | 1-methoxy-2,2,6,6-tetramethylpiperidine-4,4-diamine |
|---|---|
| PubChem CID | 89193516 |
| Molecular Formula | C10H23N3O |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.18 |
| IUPAC Name | 1-methoxy-2,2,6,6-tetramethylpiperidine-4,4-diamine |
| SMILES | CON1C(C)(C)CC(N)(N)CC1(C)C |
| InChI | InChI=1S/C10H23N3O/c1-8(2)6-10(11,12)7-9(3,4)13(8)14-5/h6-7,11-12H2,1-5H3 |
| InChIKey | PMUJUUXJPKEXJV-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|