About 2-[(3Z)-4-(8-aminoquinolin-7-yl)buta-1,3-dien-2-yl]phenol
2-[(3Z)-4-(8-aminoquinolin-7-yl)buta-1,3-dien-2-yl]phenol (PubChem CID 89193765) has the molecular formula C19H16N2O
and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-[(3Z)-4-(8-aminoquinolin-7-yl)buta-1,3-dien-2-yl]phenol.
Molecular Properties
| Compound Name | 2-[(3Z)-4-(8-aminoquinolin-7-yl)buta-1,3-dien-2-yl]phenol |
| PubChem CID | 89193765 |
| Molecular Formula | C19H16N2O |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 2-[(3Z)-4-(8-aminoquinolin-7-yl)buta-1,3-dien-2-yl]phenol |
| SMILES | C=C(/C=C\c1ccc2cccnc2c1N)c1ccccc1O |
| InChI | InChI=1S/C19H16N2O/c1-13(16-6-2-3-7-17(16)22)8-9-14-10-11-15-5-4-12-21-19(15)18(14)20/h2-12,22H,1,20H2/b9-8- |
| InChIKey | BRJJZXLUARXMGL-HJWRWDBZSA-N |
| XLogP | 4.25 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3Z)-4-(8-aminoquinolin-7-yl)buta-1,3-dien-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3Z)-4-(8-aminoquinolin-7-yl)buta-1,3-dien-2-yl]phenol?
The IUPAC name of 2-[(3Z)-4-(8-aminoquinolin-7-yl)buta-1,3-dien-2-yl]phenol (CID 89193765) is 2-[(3Z)-4-(8-aminoquinolin-7-yl)buta-1,3-dien-2-yl]phenol.
What is the SMILES notation for 2-[(3Z)-4-(8-aminoquinolin-7-yl)buta-1,3-dien-2-yl]phenol?
The canonical SMILES for 2-[(3Z)-4-(8-aminoquinolin-7-yl)buta-1,3-dien-2-yl]phenol is C=C(/C=C\c1ccc2cccnc2c1N)c1ccccc1O.
What is the InChIKey of 2-[(3Z)-4-(8-aminoquinolin-7-yl)buta-1,3-dien-2-yl]phenol?
The InChIKey is BRJJZXLUARXMGL-HJWRWDBZSA-N. The full InChI is InChI=1S/C19H16N2O/c1-13(16-6-2-3-7-17(16)22)8-9-14-10-11-15-5-4-12-21-19(15)18(14)20/h2-12,22H,1,20H2/b9-8-.
What are the key properties of 2-[(3Z)-4-(8-aminoquinolin-7-yl)buta-1,3-dien-2-yl]phenol?
2-[(3Z)-4-(8-aminoquinolin-7-yl)buta-1,3-dien-2-yl]phenol has a molecular weight of 288.35 g/mol, XLogP of 4.25, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3Z)-4-(8-aminoquinolin-7-yl)buta-1,3-dien-2-yl]phenol is sourced from PubChem (CID 89193765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).