About (5Z,7E)-7-(diethylamino)-4-methylnona-5,7-dienal
(5Z,7E)-7-(diethylamino)-4-methylnona-5,7-dienal (PubChem CID 89193963) has the molecular formula C14H25NO
and a molecular weight of 223.36 g/mol. Its IUPAC name is (5Z,7E)-7-(diethylamino)-4-methylnona-5,7-dienal.
Molecular Properties
| Compound Name | (5Z,7E)-7-(diethylamino)-4-methylnona-5,7-dienal |
| PubChem CID | 89193963 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | (5Z,7E)-7-(diethylamino)-4-methylnona-5,7-dienal |
| SMILES | C/C=C(\C=C/C(C)CCC=O)N(CC)CC |
| InChI | InChI=1S/C14H25NO/c1-5-14(15(6-2)7-3)11-10-13(4)9-8-12-16/h5,10-13H,6-9H2,1-4H3/b11-10-,14-5+ |
| InChIKey | CQMPFNQMVMYIAS-VKVAAMHVSA-N |
| XLogP | 3.40 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (5Z,7E)-7-(diethylamino)-4-methylnona-5,7-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z,7E)-7-(diethylamino)-4-methylnona-5,7-dienal?
The IUPAC name of (5Z,7E)-7-(diethylamino)-4-methylnona-5,7-dienal (CID 89193963) is (5Z,7E)-7-(diethylamino)-4-methylnona-5,7-dienal.
What is the SMILES notation for (5Z,7E)-7-(diethylamino)-4-methylnona-5,7-dienal?
The canonical SMILES for (5Z,7E)-7-(diethylamino)-4-methylnona-5,7-dienal is C/C=C(\C=C/C(C)CCC=O)N(CC)CC.
What is the InChIKey of (5Z,7E)-7-(diethylamino)-4-methylnona-5,7-dienal?
The InChIKey is CQMPFNQMVMYIAS-VKVAAMHVSA-N. The full InChI is InChI=1S/C14H25NO/c1-5-14(15(6-2)7-3)11-10-13(4)9-8-12-16/h5,10-13H,6-9H2,1-4H3/b11-10-,14-5+.
What are the key properties of (5Z,7E)-7-(diethylamino)-4-methylnona-5,7-dienal?
(5Z,7E)-7-(diethylamino)-4-methylnona-5,7-dienal has a molecular weight of 223.36 g/mol, XLogP of 3.40, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z,7E)-7-(diethylamino)-4-methylnona-5,7-dienal is sourced from PubChem (CID 89193963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).