About hydrazinyl-(2,4,6-trimethylcyclohex-2-en-1-yl)methanol
hydrazinyl-(2,4,6-trimethylcyclohex-2-en-1-yl)methanol (PubChem CID 89193964) has the molecular formula C10H20N2O
and a molecular weight of 184.28 g/mol. Its IUPAC name is hydrazinyl-(2,4,6-trimethylcyclohex-2-en-1-yl)methanol.
Molecular Properties
| Compound Name | hydrazinyl-(2,4,6-trimethylcyclohex-2-en-1-yl)methanol |
| PubChem CID | 89193964 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | hydrazinyl-(2,4,6-trimethylcyclohex-2-en-1-yl)methanol |
| SMILES | CC1=CC(C)CC(C)C1C(O)NN |
| InChI | InChI=1S/C10H20N2O/c1-6-4-7(2)9(8(3)5-6)10(13)12-11/h4,6,8-10,12-13H,5,11H2,1-3H3 |
| InChIKey | HBIAJVDRZLQOFG-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hydrazinyl-(2,4,6-trimethylcyclohex-2-en-1-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrazinyl-(2,4,6-trimethylcyclohex-2-en-1-yl)methanol?
The IUPAC name of hydrazinyl-(2,4,6-trimethylcyclohex-2-en-1-yl)methanol (CID 89193964) is hydrazinyl-(2,4,6-trimethylcyclohex-2-en-1-yl)methanol.
What is the SMILES notation for hydrazinyl-(2,4,6-trimethylcyclohex-2-en-1-yl)methanol?
The canonical SMILES for hydrazinyl-(2,4,6-trimethylcyclohex-2-en-1-yl)methanol is CC1=CC(C)CC(C)C1C(O)NN.
What is the InChIKey of hydrazinyl-(2,4,6-trimethylcyclohex-2-en-1-yl)methanol?
The InChIKey is HBIAJVDRZLQOFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O/c1-6-4-7(2)9(8(3)5-6)10(13)12-11/h4,6,8-10,12-13H,5,11H2,1-3H3.
What are the key properties of hydrazinyl-(2,4,6-trimethylcyclohex-2-en-1-yl)methanol?
hydrazinyl-(2,4,6-trimethylcyclohex-2-en-1-yl)methanol has a molecular weight of 184.28 g/mol, XLogP of 1.01, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydrazinyl-(2,4,6-trimethylcyclohex-2-en-1-yl)methanol is sourced from PubChem (CID 89193964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).