C12H19N — CID 89193995
(2E)-1,4,4-trimethyl-2-[(2Z)-penta-2,4-dienylidene]pyrrolidine (PubChem CID 89193995) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is (2E)-1,4,4-trimethyl-2-[(2Z)-penta-2,4-dienylidene]pyrrolidine.
| Compound Name | (2E)-1,4,4-trimethyl-2-[(2Z)-penta-2,4-dienylidene]pyrrolidine |
|---|---|
| PubChem CID | 89193995 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | (2E)-1,4,4-trimethyl-2-[(2Z)-penta-2,4-dienylidene]pyrrolidine |
| SMILES | C=C/C=C\C=C1/CC(C)(C)CN1C |
| InChI | InChI=1S/C12H19N/c1-5-6-7-8-11-9-12(2,3)10-13(11)4/h5-8H,1,9-10H2,2-4H3/b7-6-,11-8+ |
| InChIKey | DSRINXYKBGTLRN-BQGCWICQSA-N |
| XLogP | 2.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|