C16H29NO4 — CID 89194256
2-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)propyl 4-oxobutanoate (PubChem CID 89194256) has the molecular formula C16H29NO4 and a molecular weight of 299.41 g/mol. Its IUPAC name is 2-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)propyl 4-oxobutanoate.
| Compound Name | 2-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)propyl 4-oxobutanoate |
|---|---|
| PubChem CID | 89194256 |
| Molecular Formula | C16H29NO4 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | 2-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)propyl 4-oxobutanoate |
| SMILES | CC(COC(=O)CCC=O)N1C(C)(C)CC(O)CC1(C)C |
| InChI | InChI=1S/C16H29NO4/c1-12(11-21-14(20)7-6-8-18)17-15(2,3)9-13(19)10-16(17,4)5/h8,12-13,19H,6-7,9-11H2,1-5H3 |
| InChIKey | MPRCFOXFKBPPPZ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|