About (2Z)-2-ethylidene-4,5-dimethylmorpholin-3-one
(2Z)-2-ethylidene-4,5-dimethylmorpholin-3-one (PubChem CID 89194290) has the molecular formula C8H13NO2
and a molecular weight of 155.20 g/mol. Its IUPAC name is (2Z)-2-ethylidene-4,5-dimethylmorpholin-3-one.
Molecular Properties
| Compound Name | (2Z)-2-ethylidene-4,5-dimethylmorpholin-3-one |
| PubChem CID | 89194290 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | (2Z)-2-ethylidene-4,5-dimethylmorpholin-3-one |
| SMILES | C/C=C1\OCC(C)N(C)C1=O |
| InChI | InChI=1S/C8H13NO2/c1-4-7-8(10)9(3)6(2)5-11-7/h4,6H,5H2,1-3H3/b7-4- |
| InChIKey | LTTJXFGSMHEJLQ-DAXSKMNVSA-N |
| XLogP | 0.77 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-ethylidene-4,5-dimethylmorpholin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-ethylidene-4,5-dimethylmorpholin-3-one?
The IUPAC name of (2Z)-2-ethylidene-4,5-dimethylmorpholin-3-one (CID 89194290) is (2Z)-2-ethylidene-4,5-dimethylmorpholin-3-one.
What is the SMILES notation for (2Z)-2-ethylidene-4,5-dimethylmorpholin-3-one?
The canonical SMILES for (2Z)-2-ethylidene-4,5-dimethylmorpholin-3-one is C/C=C1\OCC(C)N(C)C1=O.
What is the InChIKey of (2Z)-2-ethylidene-4,5-dimethylmorpholin-3-one?
The InChIKey is LTTJXFGSMHEJLQ-DAXSKMNVSA-N. The full InChI is InChI=1S/C8H13NO2/c1-4-7-8(10)9(3)6(2)5-11-7/h4,6H,5H2,1-3H3/b7-4-.
What are the key properties of (2Z)-2-ethylidene-4,5-dimethylmorpholin-3-one?
(2Z)-2-ethylidene-4,5-dimethylmorpholin-3-one has a molecular weight of 155.20 g/mol, XLogP of 0.77, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-ethylidene-4,5-dimethylmorpholin-3-one is sourced from PubChem (CID 89194290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).