C17H21NO2 — CID 89194436
2-[[(2E,4E,6E,8E)-2,6-dimethyl-10-methylidenedodeca-2,4,6,8,11-pentaenylidene]amino]acetic acid (PubChem CID 89194436) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is 2-[[(2E,4E,6E,8E)-2,6-dimethyl-10-methylidenedodeca-2,4,6,8,11-pentaenylidene]amino]acetic acid.
| Compound Name | 2-[[(2E,4E,6E,8E)-2,6-dimethyl-10-methylidenedodeca-2,4,6,8,11-pentaenylidene]amino]acetic acid |
|---|---|
| PubChem CID | 89194436 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 2-[[(2E,4E,6E,8E)-2,6-dimethyl-10-methylidenedodeca-2,4,6,8,11-pentaenylidene]amino]acetic acid |
| SMILES | C=CC(=C)/C=C/C=C(C)/C=C/C=C(C)/C=N/CC(=O)O |
| InChI | InChI=1S/C17H21NO2/c1-5-14(2)8-6-9-15(3)10-7-11-16(4)12-18-13-17(19)20/h5-12H,1-2,13H2,3-4H3,(H,19,20)/b8-6+,10-7+,15-9+,16-11+,18-12+ |
| InChIKey | HIZNWNBXHONNQD-JIWVLCDISA-N |
| XLogP | 3.89 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|