C13H28O9 — CID 89194517
2,5-dimethylundecane-2,3,4,5,6,7,8,9,10-nonol (PubChem CID 89194517) has the molecular formula C13H28O9 and a molecular weight of 328.36 g/mol. Its IUPAC name is 2,5-dimethylundecane-2,3,4,5,6,7,8,9,10-nonol.
| Compound Name | 2,5-dimethylundecane-2,3,4,5,6,7,8,9,10-nonol |
|---|---|
| PubChem CID | 89194517 |
| Molecular Formula | C13H28O9 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 2,5-dimethylundecane-2,3,4,5,6,7,8,9,10-nonol |
| SMILES | CC(O)C(O)C(O)C(O)C(O)C(C)(O)C(O)C(O)C(C)(C)O |
| InChI | InChI=1S/C13H28O9/c1-5(14)6(15)7(16)8(17)9(18)13(4,22)11(20)10(19)12(2,3)21/h5-11,14-22H,1-4H3 |
| InChIKey | CYJVFFBXOHHJMK-UHFFFAOYSA-N |
| XLogP | -3.95 |
| TPSA | 182.07 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | -3.95 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |