C22H25IO6S — CID 89195072
[(1S)-9,13-dihydroxy-12-iodo-2,6,10-trimethyl-8-oxatetracyclo[7.3.1.01,5.06,10]trideca-4,11-dien-11-yl] 4-methylbenzenesulfonate (PubChem CID 89195072) has the molecular formula C22H25IO6S and a molecular weight of 544.41 g/mol. Its IUPAC name is [(1S)-9,13-dihydroxy-12-iodo-2,6,10-trimethyl-8-oxatetracyclo[7.3.1.01,5.06,10]trideca-4,11-dien-11-yl] 4-methylbenzenesulfonate.
| Compound Name | [(1S)-9,13-dihydroxy-12-iodo-2,6,10-trimethyl-8-oxatetracyclo[7.3.1.01,5.06,10]trideca-4,11-dien-11-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 89195072 |
| Molecular Formula | C22H25IO6S |
| Molecular Weight | 544.41 g/mol |
| Exact Mass | 544.04 |
| IUPAC Name | [(1S)-9,13-dihydroxy-12-iodo-2,6,10-trimethyl-8-oxatetracyclo[7.3.1.01,5.06,10]trideca-4,11-dien-11-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2=C(I)[C@]34C(=CCC3C)C3(C)COC(O)(C4O)C23C)cc1 |
| InChI | InChI=1S/C22H25IO6S/c1-12-5-8-14(9-6-12)30(26,27)29-17-16(23)21-13(2)7-10-15(21)19(3)11-28-22(25,18(21)24)20(17,19)4/h5-6,8-10,13,18,24-25H,7,11H2,1-4H3/t13?,18?,19?,20?,21-,22?/m1/s1 |
| InChIKey | ZFFSKRTZDNMHAM-IXDXAHJXSA-N |
| XLogP | 3.42 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|