C11H16O3 — CID 89195244
[(1R,5R)-3-ethyl-5-(hydroxymethyl)-8-oxabicyclo[3.2.1]octa-3,6-dien-1-yl]methanol (PubChem CID 89195244) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is [(1R,5R)-3-ethyl-5-(hydroxymethyl)-8-oxabicyclo[3.2.1]octa-3,6-dien-1-yl]methanol.
| Compound Name | [(1R,5R)-3-ethyl-5-(hydroxymethyl)-8-oxabicyclo[3.2.1]octa-3,6-dien-1-yl]methanol |
|---|---|
| PubChem CID | 89195244 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | [(1R,5R)-3-ethyl-5-(hydroxymethyl)-8-oxabicyclo[3.2.1]octa-3,6-dien-1-yl]methanol |
| SMILES | CCC1=C[C@@]2(CO)C=C[C@@](CO)(C1)O2 |
| InChI | InChI=1S/C11H16O3/c1-2-9-5-10(7-12)3-4-11(6-9,8-13)14-10/h3-5,12-13H,2,6-8H2,1H3/t10-,11+/m1/s1 |
| InChIKey | SCYFFOSLXPCECC-MNOVXSKESA-N |
| XLogP | 0.78 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|