C9H10Cl2N2O — CID 89195456
2-(4,5-dichlorocyclohexa-1,5-dien-1-yl)imidazolidin-4-one (PubChem CID 89195456) has the molecular formula C9H10Cl2N2O and a molecular weight of 233.10 g/mol. Its IUPAC name is 2-(4,5-dichlorocyclohexa-1,5-dien-1-yl)imidazolidin-4-one.
| Compound Name | 2-(4,5-dichlorocyclohexa-1,5-dien-1-yl)imidazolidin-4-one |
|---|---|
| PubChem CID | 89195456 |
| Molecular Formula | C9H10Cl2N2O |
| Molecular Weight | 233.10 g/mol |
| Exact Mass | 232.02 |
| IUPAC Name | 2-(4,5-dichlorocyclohexa-1,5-dien-1-yl)imidazolidin-4-one |
| SMILES | O=C1CNC(C2=CCC(Cl)C(Cl)=C2)N1 |
| InChI | InChI=1S/C9H10Cl2N2O/c10-6-2-1-5(3-7(6)11)9-12-4-8(14)13-9/h1,3,6,9,12H,2,4H2,(H,13,14) |
| InChIKey | KEIMCJUNTUEAOS-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.10 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|