C11H20O2 — CID 89195947
[2-(hydroxymethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl]methanol (PubChem CID 89195947) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is [2-(hydroxymethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl]methanol.
| Compound Name | [2-(hydroxymethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl]methanol |
|---|---|
| PubChem CID | 89195947 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | [2-(hydroxymethyl)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl]methanol |
| SMILES | OCC1CCC2CC(CO)CC2C1 |
| InChI | InChI=1S/C11H20O2/c12-6-8-1-2-10-4-9(7-13)5-11(10)3-8/h8-13H,1-7H2 |
| InChIKey | BHTKZVWFOJUTIB-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |