C12H13N — CID 89196194
(5E)-3-methylideneundeca-1,5,7,8,10-pentaen-4-imine (PubChem CID 89196194) has the molecular formula C12H13N and a molecular weight of 171.24 g/mol. Its IUPAC name is (5E)-3-methylideneundeca-1,5,7,8,10-pentaen-4-imine.
| Compound Name | (5E)-3-methylideneundeca-1,5,7,8,10-pentaen-4-imine |
|---|---|
| PubChem CID | 89196194 |
| Molecular Formula | C12H13N |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | (5E)-3-methylideneundeca-1,5,7,8,10-pentaen-4-imine |
| SMILES | [H]N=C(/C=C/C=C=CC=C)C(=C)C=C |
| InChI | InChI=1S/C12H13N/c1-4-6-7-8-9-10-12(13)11(3)5-2/h4-6,8-10,13H,1-3H2/b10-9+,13-12- |
| InChIKey | UWEHSMXLSLPSCE-FWIFIWDMSA-N |
| XLogP | 3.20 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|