C14H19F11O — CID 89196289
1,1,1,2-tetrafluoro-2,3-dimethyl-3-[1,1,2,3-tetrafluoro-3-methyl-2-(trifluoromethyl)butoxy]hexane (PubChem CID 89196289) has the molecular formula C14H19F11O and a molecular weight of 412.28 g/mol. Its IUPAC name is 1,1,1,2-tetrafluoro-2,3-dimethyl-3-[1,1,2,3-tetrafluoro-3-methyl-2-(trifluoromethyl)butoxy]hexane.
| Compound Name | 1,1,1,2-tetrafluoro-2,3-dimethyl-3-[1,1,2,3-tetrafluoro-3-methyl-2-(trifluoromethyl)butoxy]hexane |
|---|---|
| PubChem CID | 89196289 |
| Molecular Formula | C14H19F11O |
| Molecular Weight | 412.28 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 1,1,1,2-tetrafluoro-2,3-dimethyl-3-[1,1,2,3-tetrafluoro-3-methyl-2-(trifluoromethyl)butoxy]hexane |
| SMILES | CCCC(C)(OC(F)(F)C(F)(C(C)(C)F)C(F)(F)F)C(C)(F)C(F)(F)F |
| InChI | InChI=1S/C14H19F11O/c1-6-7-9(4,10(5,16)12(18,19)20)26-14(24,25)11(17,8(2,3)15)13(21,22)23/h6-7H2,1-5H3 |
| InChIKey | ANRVXHVUANWHNB-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.28 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |