C26H24N2 — CID 89196308
3,6-bis[(1Z)-1-phenylbuta-1,3-dienyl]benzene-1,2-diamine (PubChem CID 89196308) has the molecular formula C26H24N2 and a molecular weight of 364.49 g/mol. Its IUPAC name is 3,6-bis[(1Z)-1-phenylbuta-1,3-dienyl]benzene-1,2-diamine.
| Compound Name | 3,6-bis[(1Z)-1-phenylbuta-1,3-dienyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 89196308 |
| Molecular Formula | C26H24N2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 3,6-bis[(1Z)-1-phenylbuta-1,3-dienyl]benzene-1,2-diamine |
| SMILES | C=C/C=C(/c1ccccc1)c1ccc(/C(=C\C=C)c2ccccc2)c(N)c1N |
| InChI | InChI=1S/C26H24N2/c1-3-11-21(19-13-7-5-8-14-19)23-17-18-24(26(28)25(23)27)22(12-4-2)20-15-9-6-10-16-20/h3-18H,1-2,27-28H2/b21-11-,22-12- |
| InChIKey | LLNMVHSHNWCYSX-IINORCHSSA-N |
| XLogP | 6.09 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|