C13H22NO3P — CID 89196445
methyl-[(2S)-3-phenyl-2-(propylamino)propoxy]phosphinic acid (PubChem CID 89196445) has the molecular formula C13H22NO3P and a molecular weight of 271.30 g/mol. Its IUPAC name is methyl-[(2S)-3-phenyl-2-(propylamino)propoxy]phosphinic acid.
| Compound Name | methyl-[(2S)-3-phenyl-2-(propylamino)propoxy]phosphinic acid |
|---|---|
| PubChem CID | 89196445 |
| Molecular Formula | C13H22NO3P |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | methyl-[(2S)-3-phenyl-2-(propylamino)propoxy]phosphinic acid |
| SMILES | CCCN[C@H](COP(C)(=O)O)Cc1ccccc1 |
| InChI | InChI=1S/C13H22NO3P/c1-3-9-14-13(11-17-18(2,15)16)10-12-7-5-4-6-8-12/h4-8,13-14H,3,9-11H2,1-2H3,(H,15,16)/t13-/m0/s1 |
| InChIKey | FCJCUHLSKWZOQT-ZDUSSCGKSA-N |
| XLogP | 2.43 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|