C23H37N3O10 — CID 89196572
[3-[3-(4-ethyl-2-hydroxy-4-methylhexyl)-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]-2-hydroxypropyl] 2,3-dihydroxy-5-oxopentanoate (PubChem CID 89196572) has the molecular formula C23H37N3O10 and a molecular weight of 515.56 g/mol. Its IUPAC name is [3-[3-(4-ethyl-2-hydroxy-4-methylhexyl)-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]-2-hydroxypropyl] 2,3-dihydroxy-5-oxopentanoate.
| Compound Name | [3-[3-(4-ethyl-2-hydroxy-4-methylhexyl)-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]-2-hydroxypropyl] 2,3-dihydroxy-5-oxopentanoate |
|---|---|
| PubChem CID | 89196572 |
| Molecular Formula | C23H37N3O10 |
| Molecular Weight | 515.56 g/mol |
| Exact Mass | 515.25 |
| IUPAC Name | [3-[3-(4-ethyl-2-hydroxy-4-methylhexyl)-2,4,6-trioxo-5-prop-2-enyl-1,3,5-triazinan-1-yl]-2-hydroxypropyl] 2,3-dihydroxy-5-oxopentanoate |
| SMILES | C=CCn1c(=O)n(CC(O)COC(=O)C(O)C(O)CC=O)c(=O)n(CC(O)CC(C)(CC)CC)c1=O |
| InChI | InChI=1S/C23H37N3O10/c1-5-9-24-20(33)25(12-15(28)11-23(4,6-2)7-3)22(35)26(21(24)34)13-16(29)14-36-19(32)18(31)17(30)8-10-27/h5,10,15-18,28-31H,1,6-9,11-14H2,2-4H3 |
| InChIKey | AGTQQMADUNFGEN-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 190.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.56 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|