C24H16BN3 — CID 89196743
CID 89196743 (PubChem CID 89196743) has the molecular formula C24H16BN3 and a molecular weight of 357.23 g/mol.
| Compound Name | CID 89196743 |
|---|---|
| PubChem CID | 89196743 |
| Molecular Formula | C24H16BN3 |
| Molecular Weight | 357.23 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | — |
| SMILES | [B]c1cc(-c2cccnc2)cc(-c2nc3ccccc3n2-c2ccccc2)c1 |
| InChI | InChI=1S/C24H16BN3/c25-20-14-18(17-7-6-12-26-16-17)13-19(15-20)24-27-22-10-4-5-11-23(22)28(24)21-8-2-1-3-9-21/h1-16H |
| InChIKey | YQLJWFYAQJVQPY-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.23 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|