About [(5Z)-5-[(Z)-3-aminoprop-2-enylidene]-6-methylidenecyclohexa-1,3-dien-1-yl]methanol
[(5Z)-5-[(Z)-3-aminoprop-2-enylidene]-6-methylidenecyclohexa-1,3-dien-1-yl]methanol (PubChem CID 89196782) has the molecular formula C11H13NO
and a molecular weight of 175.23 g/mol. Its IUPAC name is [(5Z)-5-[(Z)-3-aminoprop-2-enylidene]-6-methylidenecyclohexa-1,3-dien-1-yl]methanol.
Molecular Properties
| Compound Name | [(5Z)-5-[(Z)-3-aminoprop-2-enylidene]-6-methylidenecyclohexa-1,3-dien-1-yl]methanol |
| PubChem CID | 89196782 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | [(5Z)-5-[(Z)-3-aminoprop-2-enylidene]-6-methylidenecyclohexa-1,3-dien-1-yl]methanol |
| SMILES | C=c1c(CO)ccc/c1=C/C=C\N |
| InChI | InChI=1S/C11H13NO/c1-9-10(6-3-7-12)4-2-5-11(9)8-13/h2-7,13H,1,8,12H2/b7-3-,10-6- |
| InChIKey | QLUARYDRDRPVHY-XOGRUQSTSA-N |
| XLogP | -0.16 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(5Z)-5-[(Z)-3-aminoprop-2-enylidene]-6-methylidenecyclohexa-1,3-dien-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5Z)-5-[(Z)-3-aminoprop-2-enylidene]-6-methylidenecyclohexa-1,3-dien-1-yl]methanol?
The IUPAC name of [(5Z)-5-[(Z)-3-aminoprop-2-enylidene]-6-methylidenecyclohexa-1,3-dien-1-yl]methanol (CID 89196782) is [(5Z)-5-[(Z)-3-aminoprop-2-enylidene]-6-methylidenecyclohexa-1,3-dien-1-yl]methanol.
What is the SMILES notation for [(5Z)-5-[(Z)-3-aminoprop-2-enylidene]-6-methylidenecyclohexa-1,3-dien-1-yl]methanol?
The canonical SMILES for [(5Z)-5-[(Z)-3-aminoprop-2-enylidene]-6-methylidenecyclohexa-1,3-dien-1-yl]methanol is C=c1c(CO)ccc/c1=C/C=C\N.
What is the InChIKey of [(5Z)-5-[(Z)-3-aminoprop-2-enylidene]-6-methylidenecyclohexa-1,3-dien-1-yl]methanol?
The InChIKey is QLUARYDRDRPVHY-XOGRUQSTSA-N. The full InChI is InChI=1S/C11H13NO/c1-9-10(6-3-7-12)4-2-5-11(9)8-13/h2-7,13H,1,8,12H2/b7-3-,10-6-.
What are the key properties of [(5Z)-5-[(Z)-3-aminoprop-2-enylidene]-6-methylidenecyclohexa-1,3-dien-1-yl]methanol?
[(5Z)-5-[(Z)-3-aminoprop-2-enylidene]-6-methylidenecyclohexa-1,3-dien-1-yl]methanol has a molecular weight of 175.23 g/mol, XLogP of -0.16, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(5Z)-5-[(Z)-3-aminoprop-2-enylidene]-6-methylidenecyclohexa-1,3-dien-1-yl]methanol is sourced from PubChem (CID 89196782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).