C62H59F2N3O2S2 — CID 89196859
3-[5-[2-[3,5-bis(4-fluoro-N-naphthalen-1-ylanilino)phenyl]-4-hexyl-2,3-dihydrothiophen-5-yl]-3-hexylthiophen-2-yl]-2-cyanopropanoic acid (PubChem CID 89196859) has the molecular formula C62H59F2N3O2S2 and a molecular weight of 980.30 g/mol. Its IUPAC name is 3-[5-[2-[3,5-bis(4-fluoro-N-naphthalen-1-ylanilino)phenyl]-4-hexyl-2,3-dihydrothiophen-5-yl]-3-hexylthiophen-2-yl]-2-cyanopropanoic acid.
| Compound Name | 3-[5-[2-[3,5-bis(4-fluoro-N-naphthalen-1-ylanilino)phenyl]-4-hexyl-2,3-dihydrothiophen-5-yl]-3-hexylthiophen-2-yl]-2-cyanopropanoic acid |
|---|---|
| PubChem CID | 89196859 |
| Molecular Formula | C62H59F2N3O2S2 |
| Molecular Weight | 980.30 g/mol |
| Exact Mass | 979.40 |
| IUPAC Name | 3-[5-[2-[3,5-bis(4-fluoro-N-naphthalen-1-ylanilino)phenyl]-4-hexyl-2,3-dihydrothiophen-5-yl]-3-hexylthiophen-2-yl]-2-cyanopropanoic acid |
| SMILES | CCCCCCC1=C(c2cc(CCCCCC)c(CC(C#N)C(=O)O)s2)SC(c2cc(N(c3ccc(F)cc3)c3cccc4ccccc34)cc(N(c3ccc(F)cc3)c3cccc4ccccc34)c2)C1 |
| InChI | InChI=1S/C62H59F2N3O2S2/c1-3-5-7-9-19-44-37-60(70-58(44)39-47(41-65)62(68)69)61-45(20-10-8-6-4-2)38-59(71-61)46-35-52(66(50-31-27-48(63)28-32-50)56-25-15-21-42-17-11-13-23-54(42)56)40-53(36-46)67(51-33-29-49(64)30-34-51)57-26-16-22-43-18-12-14-24-55(43)57/h11-18,21-37,40,47,59H,3-10,19-20,38-39H2,1-2H3,(H,68,69) |
| InChIKey | XCEDOXOZTJIYAW-UHFFFAOYSA-N |
| XLogP | 18.72 |
| TPSA | 67.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 980.30 |
| LogP ≤ 5 | 18.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|