C42H36F8N2O2S2 — CID 89196900
(Z)-2-cyano-3-[3-hexyl-5-[3-hexyl-5-[4-(1,2,3,4,5,6,7,8-octafluoro-3,4-dihydrocarbazol-9-yl)phenyl]thiophen-2-yl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 89196900) has the molecular formula C42H36F8N2O2S2 and a molecular weight of 816.88 g/mol. Its IUPAC name is (Z)-2-cyano-3-[3-hexyl-5-[3-hexyl-5-[4-(1,2,3,4,5,6,7,8-octafluoro-3,4-dihydrocarbazol-9-yl)phenyl]thiophen-2-yl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (Z)-2-cyano-3-[3-hexyl-5-[3-hexyl-5-[4-(1,2,3,4,5,6,7,8-octafluoro-3,4-dihydrocarbazol-9-yl)phenyl]thiophen-2-yl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 89196900 |
| Molecular Formula | C42H36F8N2O2S2 |
| Molecular Weight | 816.88 g/mol |
| Exact Mass | 816.21 |
| IUPAC Name | (Z)-2-cyano-3-[3-hexyl-5-[3-hexyl-5-[4-(1,2,3,4,5,6,7,8-octafluoro-3,4-dihydrocarbazol-9-yl)phenyl]thiophen-2-yl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | CCCCCCc1cc(-c2sc(-c3ccc(-n4c5c(c6c(F)c(F)c(F)c(F)c64)C(F)C(F)C(F)=C5F)cc3)cc2CCCCCC)sc1/C=C(/C#N)C(=O)O |
| InChI | InChI=1S/C42H36F8N2O2S2/c1-3-5-7-9-11-22-17-28(55-27(22)19-24(20-51)42(53)54)41-23(12-10-8-6-4-2)18-26(56-41)21-13-15-25(16-14-21)52-39-29(31(43)33(45)35(47)37(39)49)30-32(44)34(46)36(48)38(50)40(30)52/h13-19,31,33H,3-12H2,1-2H3,(H,53,54)/b24-19- |
| InChIKey | ZPCOKUFZHUKZIO-CLCOLTQESA-N |
| XLogP | 13.85 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.88 |
| LogP ≤ 5 | 13.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|