C28H23IN2S — CID 89196905
(E)-3-[5-[4-(1,9a-dihydrocarbazol-9-yl)phenyl]-3,4-dimethylthiophen-2-yl]-2-(iodomethyl)prop-2-enenitrile (PubChem CID 89196905) has the molecular formula C28H23IN2S and a molecular weight of 546.48 g/mol. Its IUPAC name is (E)-3-[5-[4-(1,9a-dihydrocarbazol-9-yl)phenyl]-3,4-dimethylthiophen-2-yl]-2-(iodomethyl)prop-2-enenitrile.
| Compound Name | (E)-3-[5-[4-(1,9a-dihydrocarbazol-9-yl)phenyl]-3,4-dimethylthiophen-2-yl]-2-(iodomethyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 89196905 |
| Molecular Formula | C28H23IN2S |
| Molecular Weight | 546.48 g/mol |
| Exact Mass | 546.06 |
| IUPAC Name | (E)-3-[5-[4-(1,9a-dihydrocarbazol-9-yl)phenyl]-3,4-dimethylthiophen-2-yl]-2-(iodomethyl)prop-2-enenitrile |
| SMILES | Cc1c(/C=C(\C#N)CI)sc(-c2ccc(N3c4ccccc4C4=CC=CCC43)cc2)c1C |
| InChI | InChI=1S/C28H23IN2S/c1-18-19(2)28(32-27(18)15-20(16-29)17-30)21-11-13-22(14-12-21)31-25-9-5-3-7-23(25)24-8-4-6-10-26(24)31/h3-9,11-15,26H,10,16H2,1-2H3/b20-15- |
| InChIKey | YXCHPFJPMMUYQH-HKWRFOASSA-N |
| XLogP | 8.24 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.48 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|