C26H8F8N2O2S — CID 89196906
(E)-2-cyano-3-[5-[4-(1,2,3,4,5,6,7,8-octafluorocarbazol-9-yl)phenyl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 89196906) has the molecular formula C26H8F8N2O2S and a molecular weight of 564.41 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-[4-(1,2,3,4,5,6,7,8-octafluorocarbazol-9-yl)phenyl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-2-cyano-3-[5-[4-(1,2,3,4,5,6,7,8-octafluorocarbazol-9-yl)phenyl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 89196906 |
| Molecular Formula | C26H8F8N2O2S |
| Molecular Weight | 564.41 g/mol |
| Exact Mass | 564.02 |
| IUPAC Name | (E)-2-cyano-3-[5-[4-(1,2,3,4,5,6,7,8-octafluorocarbazol-9-yl)phenyl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | N#C/C(=C\c1ccc(-c2ccc(-n3c4c(F)c(F)c(F)c(F)c4c4c(F)c(F)c(F)c(F)c43)cc2)s1)C(=O)O |
| InChI | InChI=1S/C26H8F8N2O2S/c27-16-14-15-17(28)19(30)21(32)23(34)25(15)36(24(14)22(33)20(31)18(16)29)11-3-1-9(2-4-11)13-6-5-12(39-13)7-10(8-35)26(37)38/h1-7H,(H,37,38)/b10-7+ |
| InChIKey | VNLSIXSRZOHCBQ-JXMROGBWSA-N |
| XLogP | 7.62 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.41 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|